C16H24N2O2 — CID 82539109
6-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]hexanoic acid (PubChem CID 82539109) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 6-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]hexanoic acid.
| Compound Name | 6-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 82539109 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 6-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)amino]hexanoic acid |
| SMILES | CN1CCCc2cc(NCCCCCC(=O)O)ccc21 |
| InChI | InChI=1S/C16H24N2O2/c1-18-11-5-6-13-12-14(8-9-15(13)18)17-10-4-2-3-7-16(19)20/h8-9,12,17H,2-7,10-11H2,1H3,(H,19,20) |
| InChIKey | GPYCBBCNVBHGGO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|