C16H19NO2 — CID 14979105
6-(naphthalen-2-ylamino)hexanoic acid (PubChem CID 14979105) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 6-(naphthalen-2-ylamino)hexanoic acid.
| Compound Name | 6-(naphthalen-2-ylamino)hexanoic acid |
|---|---|
| PubChem CID | 14979105 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 6-(naphthalen-2-ylamino)hexanoic acid |
| SMILES | O=C(O)CCCCCNc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H19NO2/c18-16(19)8-2-1-5-11-17-15-10-9-13-6-3-4-7-14(13)12-15/h3-4,6-7,9-10,12,17H,1-2,5,8,11H2,(H,18,19) |
| InChIKey | KMSXTPLHIMFBSV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|