About 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol
3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol (PubChem CID 82539750) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol |
| PubChem CID | 82539750 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol |
| SMILES | CN1CCc2cc(NCCCO)ccc21 |
| InChI | InChI=1S/C12H18N2O/c1-14-7-5-10-9-11(3-4-12(10)14)13-6-2-8-15/h3-4,9,13,15H,2,5-8H2,1H3 |
| InChIKey | JTUINFWHHVNOLX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol?
The IUPAC name of 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol (CID 82539750) is 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol is CN1CCc2cc(NCCCO)ccc21.
What is the InChIKey of 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol?
The InChIKey is JTUINFWHHVNOLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-14-7-5-10-9-11(3-4-12(10)14)13-6-2-8-15/h3-4,9,13,15H,2,5-8H2,1H3.
What are the key properties of 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol?
3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol has a molecular weight of 206.29 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-methyl-2,3-dihydroindol-5-yl)amino]propan-1-ol is sourced from PubChem (CID 82539750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).