C15H22N2O2 — CID 110485516
N-(5-hydroxypentyl)-1-methyl-2,3-dihydroindole-5-carboxamide (PubChem CID 110485516) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-1-methyl-2,3-dihydroindole-5-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-1-methyl-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 110485516 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-(5-hydroxypentyl)-1-methyl-2,3-dihydroindole-5-carboxamide |
| SMILES | CN1CCc2cc(C(=O)NCCCCCO)ccc21 |
| InChI | InChI=1S/C15H22N2O2/c1-17-9-7-12-11-13(5-6-14(12)17)15(19)16-8-3-2-4-10-18/h5-6,11,18H,2-4,7-10H2,1H3,(H,16,19) |
| InChIKey | WTOXNGHQAXDHTQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|