C13H19NO — CID 91428758
ethane;1-(1-methyl-2,3-dihydroindol-5-yl)ethanone (PubChem CID 91428758) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;1-(1-methyl-2,3-dihydroindol-5-yl)ethanone.
| Compound Name | ethane;1-(1-methyl-2,3-dihydroindol-5-yl)ethanone |
|---|---|
| PubChem CID | 91428758 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | ethane;1-(1-methyl-2,3-dihydroindol-5-yl)ethanone |
| SMILES | CC.CC(=O)c1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C11H13NO.C2H6/c1-8(13)9-3-4-11-10(7-9)5-6-12(11)2;1-2/h3-4,7H,5-6H2,1-2H3;1-2H3 |
| InChIKey | HFUDEZKSPFIVFV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |