C17H18N2O — CID 82536649
1-[4-[(1-methyl-2,3-dihydroindol-5-yl)amino]phenyl]ethanone (PubChem CID 82536649) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[4-[(1-methyl-2,3-dihydroindol-5-yl)amino]phenyl]ethanone.
| Compound Name | 1-[4-[(1-methyl-2,3-dihydroindol-5-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 82536649 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-[4-[(1-methyl-2,3-dihydroindol-5-yl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2ccc3c(c2)CCN3C)cc1 |
| InChI | InChI=1S/C17H18N2O/c1-12(20)13-3-5-15(6-4-13)18-16-7-8-17-14(11-16)9-10-19(17)2/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | BXIBFDJLLRQLBQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|