C16H17FN2 — CID 82537194
N-(4-fluorophenyl)-1-methyl-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 82537194) has the molecular formula C16H17FN2 and a molecular weight of 256.32 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-methyl-3,4-dihydro-2H-quinolin-6-amine.
| Compound Name | N-(4-fluorophenyl)-1-methyl-3,4-dihydro-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 82537194 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-(4-fluorophenyl)-1-methyl-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | CN1CCCc2cc(Nc3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C16H17FN2/c1-19-10-2-3-12-11-15(8-9-16(12)19)18-14-6-4-13(17)5-7-14/h4-9,11,18H,2-3,10H2,1H3 |
| InChIKey | JWMWKUHYSXHLQX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|