C22H32N2OSi — CID 140666668
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-methyl-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 140666668) has the molecular formula C22H32N2OSi and a molecular weight of 368.60 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-methyl-3,4-dihydro-2H-quinolin-6-amine.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-methyl-3,4-dihydro-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 140666668 |
| Molecular Formula | C22H32N2OSi |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-methyl-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | CN1CCCc2cc(Nc3ccc(O[Si](C)(C)C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C22H32N2OSi/c1-22(2,3)26(5,6)25-20-12-9-18(10-13-20)23-19-11-14-21-17(16-19)8-7-15-24(21)4/h9-14,16,23H,7-8,15H2,1-6H3 |
| InChIKey | RXNYZWXSDJTWOX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|