C19H24N2O — CID 82538735
N-[1-(4-methoxyphenyl)ethyl]-1-methyl-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 82538735) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)ethyl]-1-methyl-3,4-dihydro-2H-quinolin-6-amine.
| Compound Name | N-[1-(4-methoxyphenyl)ethyl]-1-methyl-3,4-dihydro-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 82538735 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | N-[1-(4-methoxyphenyl)ethyl]-1-methyl-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | COc1ccc(C(C)Nc2ccc3c(c2)CCCN3C)cc1 |
| InChI | InChI=1S/C19H24N2O/c1-14(15-6-9-18(22-3)10-7-15)20-17-8-11-19-16(13-17)5-4-12-21(19)2/h6-11,13-14,20H,4-5,12H2,1-3H3 |
| InChIKey | VPMISYLLKAFPGU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|