C20H26N2O — CID 110452960
1-methyl-N-[4-[(2-methylpropan-2-yl)oxy]phenyl]-3,4-dihydro-2H-quinolin-6-amine (PubChem CID 110452960) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-methyl-N-[4-[(2-methylpropan-2-yl)oxy]phenyl]-3,4-dihydro-2H-quinolin-6-amine.
| Compound Name | 1-methyl-N-[4-[(2-methylpropan-2-yl)oxy]phenyl]-3,4-dihydro-2H-quinolin-6-amine |
|---|---|
| PubChem CID | 110452960 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 1-methyl-N-[4-[(2-methylpropan-2-yl)oxy]phenyl]-3,4-dihydro-2H-quinolin-6-amine |
| SMILES | CN1CCCc2cc(Nc3ccc(OC(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C20H26N2O/c1-20(2,3)23-18-10-7-16(8-11-18)21-17-9-12-19-15(14-17)6-5-13-22(19)4/h7-12,14,21H,5-6,13H2,1-4H3 |
| InChIKey | YGWUOYABQPLNFE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|