C26H37N3O2Si — CID 140719406
N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2-morpholin-4-ylethyl)indol-5-amine (PubChem CID 140719406) has the molecular formula C26H37N3O2Si and a molecular weight of 451.69 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2-morpholin-4-ylethyl)indol-5-amine.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2-morpholin-4-ylethyl)indol-5-amine |
|---|---|
| PubChem CID | 140719406 |
| Molecular Formula | C26H37N3O2Si |
| Molecular Weight | 451.69 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2-morpholin-4-ylethyl)indol-5-amine |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(Nc2ccc3c(ccn3CCN3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C26H37N3O2Si/c1-26(2,3)32(4,5)31-24-9-6-22(7-10-24)27-23-8-11-25-21(20-23)12-13-29(25)15-14-28-16-18-30-19-17-28/h6-13,20,27H,14-19H2,1-5H3 |
| InChIKey | BJPQIZBMAVINKV-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 38.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|