C20H32Cl2N4O2 — CID 119864723
2-amino-2-methyl-N-[1-(2-morpholin-4-ylethyl)indol-5-yl]pentanamide;dihydrochloride (PubChem CID 119864723) has the molecular formula C20H32Cl2N4O2 and a molecular weight of 431.41 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[1-(2-morpholin-4-ylethyl)indol-5-yl]pentanamide;dihydrochloride.
| Compound Name | 2-amino-2-methyl-N-[1-(2-morpholin-4-ylethyl)indol-5-yl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119864723 |
| Molecular Formula | C20H32Cl2N4O2 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-amino-2-methyl-N-[1-(2-morpholin-4-ylethyl)indol-5-yl]pentanamide;dihydrochloride |
| SMILES | CCCC(C)(N)C(=O)Nc1ccc2c(ccn2CCN2CCOCC2)c1.Cl.Cl |
| InChI | InChI=1S/C20H30N4O2.2ClH/c1-3-7-20(2,21)19(25)22-17-4-5-18-16(15-17)6-8-24(18)10-9-23-11-13-26-14-12-23;;/h4-6,8,15H,3,7,9-14,21H2,1-2H3,(H,22,25);2*1H |
| InChIKey | DPHUWSXQIDMXPI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |