C17H28ClN3O5S — CID 119677515
2-amino-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-2-methylpentanamide;hydrochloride (PubChem CID 119677515) has the molecular formula C17H28ClN3O5S and a molecular weight of 421.95 g/mol. Its IUPAC name is 2-amino-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-2-methylpentanamide;hydrochloride.
| Compound Name | 2-amino-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-2-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119677515 |
| Molecular Formula | C17H28ClN3O5S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-amino-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-2-methylpentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)Nc1ccc(OC)c(S(=O)(=O)N2CCOCC2)c1.Cl |
| InChI | InChI=1S/C17H27N3O5S.ClH/c1-4-7-17(2,18)16(21)19-13-5-6-14(24-3)15(12-13)26(22,23)20-8-10-25-11-9-20;/h5-6,12H,4,7-11,18H2,1-3H3,(H,19,21);1H |
| InChIKey | BQLQETWFURQEGI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |