C24H30N4O4 — CID 56556653
1-[2-(3-methoxyphenoxy)ethyl]-3-[1-(2-morpholin-4-ylethyl)indol-5-yl]urea (PubChem CID 56556653) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[2-(3-methoxyphenoxy)ethyl]-3-[1-(2-morpholin-4-ylethyl)indol-5-yl]urea.
| Compound Name | 1-[2-(3-methoxyphenoxy)ethyl]-3-[1-(2-morpholin-4-ylethyl)indol-5-yl]urea |
|---|---|
| PubChem CID | 56556653 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-[2-(3-methoxyphenoxy)ethyl]-3-[1-(2-morpholin-4-ylethyl)indol-5-yl]urea |
| SMILES | COc1cccc(OCCNC(=O)Nc2ccc3c(ccn3CCN3CCOCC3)c2)c1 |
| InChI | InChI=1S/C24H30N4O4/c1-30-21-3-2-4-22(18-21)32-14-8-25-24(29)26-20-5-6-23-19(17-20)7-9-28(23)11-10-27-12-15-31-16-13-27/h2-7,9,17-18H,8,10-16H2,1H3,(H2,25,26,29) |
| InChIKey | FWSGWVDRUMOALO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|