About 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride
2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride (PubChem CID 23620383) has the molecular formula C15H22ClNO5
and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride |
| PubChem CID | 23620383 |
| Molecular Formula | C15H22ClNO5 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride |
| SMILES | COc1cccc(OCC(=O)OCCN2CCOCC2)c1.Cl |
| InChI | InChI=1S/C15H21NO5.ClH/c1-18-13-3-2-4-14(11-13)21-12-15(17)20-10-7-16-5-8-19-9-6-16;/h2-4,11H,5-10,12H2,1H3;1H |
| InChIKey | RAMVOKQRSQDBKH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride?
The IUPAC name of 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride (CID 23620383) is 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride.
What is the SMILES notation for 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride?
The canonical SMILES for 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride is COc1cccc(OCC(=O)OCCN2CCOCC2)c1.Cl.
What is the InChIKey of 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride?
The InChIKey is RAMVOKQRSQDBKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO5.ClH/c1-18-13-3-2-4-14(11-13)21-12-15(17)20-10-7-16-5-8-19-9-6-16;/h2-4,11H,5-10,12H2,1H3;1H.
What are the key properties of 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride?
2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride has a molecular weight of 331.80 g/mol, XLogP of 1.37, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 2-(3-methoxyphenoxy)acetate;hydrochloride is sourced from PubChem (CID 23620383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).