C20H25NO7 — CID 69135269
3-hydroxy-4-[2-(3-methoxyphenoxy)acetyl]-2-(3-morpholin-4-ylpropyl)-2H-furan-5-one (PubChem CID 69135269) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-hydroxy-4-[2-(3-methoxyphenoxy)acetyl]-2-(3-morpholin-4-ylpropyl)-2H-furan-5-one.
| Compound Name | 3-hydroxy-4-[2-(3-methoxyphenoxy)acetyl]-2-(3-morpholin-4-ylpropyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 69135269 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-hydroxy-4-[2-(3-methoxyphenoxy)acetyl]-2-(3-morpholin-4-ylpropyl)-2H-furan-5-one |
| SMILES | COc1cccc(OCC(=O)C2=C(O)C(CCCN3CCOCC3)OC2=O)c1 |
| InChI | InChI=1S/C20H25NO7/c1-25-14-4-2-5-15(12-14)27-13-16(22)18-19(23)17(28-20(18)24)6-3-7-21-8-10-26-11-9-21/h2,4-5,12,17,23H,3,6-11,13H2,1H3 |
| InChIKey | DUOVNIJFQFOCAF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|