C19H24N2O5 — CID 568033
3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-1-(2-morpholin-4-ylethyl)-2H-pyrrol-5-one (PubChem CID 568033) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-1-(2-morpholin-4-ylethyl)-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-1-(2-morpholin-4-ylethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 568033 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-1-(2-morpholin-4-ylethyl)-2H-pyrrol-5-one |
| SMILES | COc1cccc(C2C(C(C)=O)=C(O)C(=O)N2CCN2CCOCC2)c1 |
| InChI | InChI=1S/C19H24N2O5/c1-13(22)16-17(14-4-3-5-15(12-14)25-2)21(19(24)18(16)23)7-6-20-8-10-26-11-9-20/h3-5,12,17,23H,6-11H2,1-2H3 |
| InChIKey | SPBPSVXGORPDIB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |