C15H15NO6 — CID 673040
2-[(2R)-3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-5-oxo-2H-pyrrol-1-yl]acetic acid (PubChem CID 673040) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is 2-[(2R)-3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-5-oxo-2H-pyrrol-1-yl]acetic acid.
| Compound Name | 2-[(2R)-3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-5-oxo-2H-pyrrol-1-yl]acetic acid |
|---|---|
| PubChem CID | 673040 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[(2R)-3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-5-oxo-2H-pyrrol-1-yl]acetic acid |
| SMILES | COc1cccc([C@@H]2C(C(C)=O)=C(O)C(=O)N2CC(=O)O)c1 |
| InChI | InChI=1S/C15H15NO6/c1-8(17)12-13(9-4-3-5-10(6-9)22-2)16(7-11(18)19)15(21)14(12)20/h3-6,13,20H,7H2,1-2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | CDSRCLKNDCXPDM-CYBMUJFWSA-N |
| XLogP | 1.06 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |