C16H17NO6 — CID 787706
methyl 2-[(2R)-3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-5-oxo-2H-pyrrol-1-yl]acetate (PubChem CID 787706) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is methyl 2-[(2R)-3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-5-oxo-2H-pyrrol-1-yl]acetate.
| Compound Name | methyl 2-[(2R)-3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-5-oxo-2H-pyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 787706 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 2-[(2R)-3-acetyl-4-hydroxy-2-(3-methoxyphenyl)-5-oxo-2H-pyrrol-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C(O)=C(C(C)=O)[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C16H17NO6/c1-9(18)13-14(10-5-4-6-11(7-10)22-2)17(8-12(19)23-3)16(21)15(13)20/h4-7,14,20H,8H2,1-3H3/t14-/m1/s1 |
| InChIKey | ASAZPNIRHBDBNM-CQSZACIVSA-N |
| XLogP | 1.15 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |