C19H24N4O4 — CID 72887930
1-[6-(3-methoxyphenoxy)-3-pyridinyl]-3-(2-morpholin-4-ylethyl)urea (PubChem CID 72887930) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-[6-(3-methoxyphenoxy)-3-pyridinyl]-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-[6-(3-methoxyphenoxy)-3-pyridinyl]-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 72887930 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[6-(3-methoxyphenoxy)-3-pyridinyl]-3-(2-morpholin-4-ylethyl)urea |
| SMILES | COc1cccc(Oc2ccc(NC(=O)NCCN3CCOCC3)cn2)c1 |
| InChI | InChI=1S/C19H24N4O4/c1-25-16-3-2-4-17(13-16)27-18-6-5-15(14-21-18)22-19(24)20-7-8-23-9-11-26-12-10-23/h2-6,13-14H,7-12H2,1H3,(H2,20,22,24) |
| InChIKey | DPNRODDAQXZZCB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |