C14H19F2N3O3 — CID 60543377
1-(3,5-difluoro-4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)urea (PubChem CID 60543377) has the molecular formula C14H19F2N3O3 and a molecular weight of 315.32 g/mol. Its IUPAC name is 1-(3,5-difluoro-4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-(3,5-difluoro-4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 60543377 |
| Molecular Formula | C14H19F2N3O3 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(3,5-difluoro-4-methoxyphenyl)-3-(2-morpholin-4-ylethyl)urea |
| SMILES | COc1c(F)cc(NC(=O)NCCN2CCOCC2)cc1F |
| InChI | InChI=1S/C14H19F2N3O3/c1-21-13-11(15)8-10(9-12(13)16)18-14(20)17-2-3-19-4-6-22-7-5-19/h8-9H,2-7H2,1H3,(H2,17,18,20) |
| InChIKey | ANRSBWFXNHPMQO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |