C19H29N5O4 — CID 158422773
1-(2-morpholin-4-ylethyl)-3-[2-[[4-(2-oxopropyl)phenyl]carbamoylamino]ethyl]urea (PubChem CID 158422773) has the molecular formula C19H29N5O4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[2-[[4-(2-oxopropyl)phenyl]carbamoylamino]ethyl]urea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[2-[[4-(2-oxopropyl)phenyl]carbamoylamino]ethyl]urea |
|---|---|
| PubChem CID | 158422773 |
| Molecular Formula | C19H29N5O4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[2-[[4-(2-oxopropyl)phenyl]carbamoylamino]ethyl]urea |
| SMILES | CC(=O)Cc1ccc(NC(=O)NCCNC(=O)NCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C19H29N5O4/c1-15(25)14-16-2-4-17(5-3-16)23-19(27)21-7-6-20-18(26)22-8-9-24-10-12-28-13-11-24/h2-5H,6-14H2,1H3,(H2,20,22,26)(H2,21,23,27) |
| InChIKey | HARMQMJEXYNHQJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|