C13H17Cl2N3O3 — CID 22932427
1-(3,5-dichloro-4-hydroxyphenyl)-3-(2-morpholin-4-ylethyl)urea (PubChem CID 22932427) has the molecular formula C13H17Cl2N3O3 and a molecular weight of 334.20 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-hydroxyphenyl)-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-(3,5-dichloro-4-hydroxyphenyl)-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 22932427 |
| Molecular Formula | C13H17Cl2N3O3 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 1-(3,5-dichloro-4-hydroxyphenyl)-3-(2-morpholin-4-ylethyl)urea |
| SMILES | O=C(NCCN1CCOCC1)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3O3/c14-10-7-9(8-11(15)12(10)19)17-13(20)16-1-2-18-3-5-21-6-4-18/h7-8,19H,1-6H2,(H2,16,17,20) |
| InChIKey | SRGPXDDXGUPIGX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|