C19H26N4O4 — CID 108873272
1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(2-morpholin-4-ylethyl)urea (PubChem CID 108873272) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 108873272 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(2-morpholin-4-ylethyl)urea |
| SMILES | CC(C)(C)N1C(=O)c2ccc(NC(=O)NCCN3CCOCC3)cc2C1=O |
| InChI | InChI=1S/C19H26N4O4/c1-19(2,3)23-16(24)14-5-4-13(12-15(14)17(23)25)21-18(26)20-6-7-22-8-10-27-11-9-22/h4-5,12H,6-11H2,1-3H3,(H2,20,21,26) |
| InChIKey | SHYXVKJDJNXWLI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|