C22H25N3O3 — CID 108873482
1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-[2-(2-methylphenyl)ethyl]urea (PubChem CID 108873482) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-[2-(2-methylphenyl)ethyl]urea.
| Compound Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-[2-(2-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108873482 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-[2-(2-methylphenyl)ethyl]urea |
| SMILES | Cc1ccccc1CCNC(=O)Nc1ccc2c(c1)C(=O)N(C(C)(C)C)C2=O |
| InChI | InChI=1S/C22H25N3O3/c1-14-7-5-6-8-15(14)11-12-23-21(28)24-16-9-10-17-18(13-16)20(27)25(19(17)26)22(2,3)4/h5-10,13H,11-12H2,1-4H3,(H2,23,24,28) |
| InChIKey | XSRUDBUQBXJVOJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|