C16H19N3O3 — CID 108873345
1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-prop-2-enylurea (PubChem CID 108873345) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-prop-2-enylurea.
| Compound Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 108873345 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc2c(c1)C(=O)N(C(C)(C)C)C2=O |
| InChI | InChI=1S/C16H19N3O3/c1-5-8-17-15(22)18-10-6-7-11-12(9-10)14(21)19(13(11)20)16(2,3)4/h5-7,9H,1,8H2,2-4H3,(H2,17,18,22) |
| InChIKey | DVQOBJJZTSTQCL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|