C18H25N3O3 — CID 108873443
1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(3-methylbutyl)urea (PubChem CID 108873443) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(3-methylbutyl)urea.
| Compound Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 108873443 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(2-tert-butyl-1,3-dioxoisoindol-5-yl)-3-(3-methylbutyl)urea |
| SMILES | CC(C)CCNC(=O)Nc1ccc2c(c1)C(=O)N(C(C)(C)C)C2=O |
| InChI | InChI=1S/C18H25N3O3/c1-11(2)8-9-19-17(24)20-12-6-7-13-14(10-12)16(23)21(15(13)22)18(3,4)5/h6-7,10-11H,8-9H2,1-5H3,(H2,19,20,24) |
| InChIKey | FPAPONRCOJPTKF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|