C15H17N3O5 — CID 108872035
3-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)carbamoylamino]propanoic acid (PubChem CID 108872035) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)carbamoylamino]propanoic acid.
| Compound Name | 3-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 108872035 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)carbamoylamino]propanoic acid |
| SMILES | CC(C)N1C(=O)c2ccc(NC(=O)NCCC(=O)O)cc2C1=O |
| InChI | InChI=1S/C15H17N3O5/c1-8(2)18-13(21)10-4-3-9(7-11(10)14(18)22)17-15(23)16-6-5-12(19)20/h3-4,7-8H,5-6H2,1-2H3,(H,19,20)(H2,16,17,23) |
| InChIKey | KMIBGWJWJBHZAX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|