C17H21N3O5 — CID 108872110
2-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)carbamoylamino]-3-methylbutanoic acid (PubChem CID 108872110) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)carbamoylamino]-3-methylbutanoic acid.
| Compound Name | 2-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)carbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 108872110 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[(1,3-dioxo-2-propan-2-ylisoindol-5-yl)carbamoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)Nc1ccc2c(c1)C(=O)N(C(C)C)C2=O)C(=O)O |
| InChI | InChI=1S/C17H21N3O5/c1-8(2)13(16(23)24)19-17(25)18-10-5-6-11-12(7-10)15(22)20(9(3)4)14(11)21/h5-9,13H,1-4H3,(H,23,24)(H2,18,19,25) |
| InChIKey | DQAQFEOENWHQLC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|