C18H17ClN4O3 — CID 108872147
1-(4-amino-2-chlorophenyl)-3-(1,3-dioxo-2-propan-2-ylisoindol-5-yl)urea (PubChem CID 108872147) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is 1-(4-amino-2-chlorophenyl)-3-(1,3-dioxo-2-propan-2-ylisoindol-5-yl)urea.
| Compound Name | 1-(4-amino-2-chlorophenyl)-3-(1,3-dioxo-2-propan-2-ylisoindol-5-yl)urea |
|---|---|
| PubChem CID | 108872147 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-(4-amino-2-chlorophenyl)-3-(1,3-dioxo-2-propan-2-ylisoindol-5-yl)urea |
| SMILES | CC(C)N1C(=O)c2ccc(NC(=O)Nc3ccc(N)cc3Cl)cc2C1=O |
| InChI | InChI=1S/C18H17ClN4O3/c1-9(2)23-16(24)12-5-4-11(8-13(12)17(23)25)21-18(26)22-15-6-3-10(20)7-14(15)19/h3-9H,20H2,1-2H3,(H2,21,22,26) |
| InChIKey | HBFKCZVAHUKMAI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|