C19H27N5O3 — CID 108872533
1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(2-piperazin-1-ylethyl)urea (PubChem CID 108872533) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(2-piperazin-1-ylethyl)urea.
| Compound Name | 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 108872533 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 1-[2-(2-methylpropyl)-1,3-dioxoisoindol-5-yl]-3-(2-piperazin-1-ylethyl)urea |
| SMILES | CC(C)CN1C(=O)c2ccc(NC(=O)NCCN3CCNCC3)cc2C1=O |
| InChI | InChI=1S/C19H27N5O3/c1-13(2)12-24-17(25)15-4-3-14(11-16(15)18(24)26)22-19(27)21-7-10-23-8-5-20-6-9-23/h3-4,11,13,20H,5-10,12H2,1-2H3,(H2,21,22,27) |
| InChIKey | FBDDSSVFYYYNBA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|