C20H33N3O5 — CID 108869740
1-(3-morpholin-4-ylpropyl)-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869740) has the molecular formula C20H33N3O5 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869740 |
| Molecular Formula | C20H33N3O5 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)NCCCN2CCOCC2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H33N3O5/c1-4-26-17-14-16(15-18(27-5-2)19(17)28-6-3)22-20(24)21-8-7-9-23-10-12-25-13-11-23/h14-15H,4-13H2,1-3H3,(H2,21,22,24) |
| InChIKey | NJHJXWNLYFLODC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|