C18H29N3O5 — CID 113217074
1-(2-morpholin-4-ylethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea (PubChem CID 113217074) has the molecular formula C18H29N3O5 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(2-morpholin-4-ylethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 113217074 |
| Molecular Formula | C18H29N3O5 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea |
| SMILES | COc1cc(CCNC(=O)NCCN2CCOCC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H29N3O5/c1-23-15-12-14(13-16(24-2)17(15)25-3)4-5-19-18(22)20-6-7-21-8-10-26-11-9-21/h12-13H,4-11H2,1-3H3,(H2,19,20,22) |
| InChIKey | ZMPARLLZZWBJNG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |