C21H35N5O5 — CID 111777522
N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111777522) has the molecular formula C21H35N5O5 and a molecular weight of 437.54 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111777522 |
| Molecular Formula | C21H35N5O5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | COc1cc(C/N=C(\NCCN2CCOCC2)NCC(=O)N(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C21H35N5O5/c1-25(2)19(27)15-24-21(22-6-7-26-8-10-31-11-9-26)23-14-16-12-17(28-3)20(30-5)18(13-16)29-4/h12-13H,6-11,14-15H2,1-5H3,(H2,22,23,24) |
| InChIKey | QIRXJMDAJMNXNF-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|