C16H28IN5O2S — CID 111777597
N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111777597) has the molecular formula C16H28IN5O2S and a molecular weight of 481.40 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111777597 |
| Molecular Formula | C16H28IN5O2S |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N,N-dimethyl-2-[[N-(2-morpholin-4-ylethyl)-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ccsc1)NCCN1CCOCC1.I |
| InChI | InChI=1S/C16H27N5O2S.HI/c1-20(2)15(22)12-19-16(18-11-14-3-10-24-13-14)17-4-5-21-6-8-23-9-7-21;/h3,10,13H,4-9,11-12H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | CUQNWOZPVZGEMG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|