C13H21IN4OS — CID 111365504
N,N-dimethyl-2-[[N-prop-2-enyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111365504) has the molecular formula C13H21IN4OS and a molecular weight of 408.31 g/mol. Its IUPAC name is N,N-dimethyl-2-[[N-prop-2-enyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[N-prop-2-enyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111365504 |
| Molecular Formula | C13H21IN4OS |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N,N-dimethyl-2-[[N-prop-2-enyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1ccsc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C13H20N4OS.HI/c1-4-6-14-13(16-9-12(18)17(2)3)15-8-11-5-7-19-10-11;/h4-5,7,10H,1,6,8-9H2,2-3H3,(H2,14,15,16);1H |
| InChIKey | STSUFUIPXXFOIE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|