C18H28N4O3 — CID 136534293
1-(6-cyclopentyloxy-3-pyridinyl)-3-[2-(1,4-oxazepan-4-yl)ethyl]urea (PubChem CID 136534293) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-(6-cyclopentyloxy-3-pyridinyl)-3-[2-(1,4-oxazepan-4-yl)ethyl]urea.
| Compound Name | 1-(6-cyclopentyloxy-3-pyridinyl)-3-[2-(1,4-oxazepan-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 136534293 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-(6-cyclopentyloxy-3-pyridinyl)-3-[2-(1,4-oxazepan-4-yl)ethyl]urea |
| SMILES | O=C(NCCN1CCCOCC1)Nc1ccc(OC2CCCC2)nc1 |
| InChI | InChI=1S/C18H28N4O3/c23-18(19-8-10-22-9-3-12-24-13-11-22)21-15-6-7-17(20-14-15)25-16-4-1-2-5-16/h6-7,14,16H,1-5,8-13H2,(H2,19,21,23) |
| InChIKey | CZZVVJJWWWMACT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |