C16H23N3O4S — CID 136534294
1-(6-cyclopentyloxy-3-pyridinyl)-3-(1,1-dioxothian-4-yl)urea (PubChem CID 136534294) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 1-(6-cyclopentyloxy-3-pyridinyl)-3-(1,1-dioxothian-4-yl)urea.
| Compound Name | 1-(6-cyclopentyloxy-3-pyridinyl)-3-(1,1-dioxothian-4-yl)urea |
|---|---|
| PubChem CID | 136534294 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-(6-cyclopentyloxy-3-pyridinyl)-3-(1,1-dioxothian-4-yl)urea |
| SMILES | O=C(Nc1ccc(OC2CCCC2)nc1)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H23N3O4S/c20-16(18-12-7-9-24(21,22)10-8-12)19-13-5-6-15(17-11-13)23-14-3-1-2-4-14/h5-6,11-12,14H,1-4,7-10H2,(H2,18,19,20) |
| InChIKey | SOGGLVJSLKWERN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |