C14H20N4O4S — CID 53498070
1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea (PubChem CID 53498070) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 53498070 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea |
| SMILES | O=C(Nc1ccc(N2CCOCC2)nc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20N4O4S/c19-14(17-12-3-8-23(20,21)10-12)16-11-1-2-13(15-9-11)18-4-6-22-7-5-18/h1-2,9,12H,3-8,10H2,(H2,16,17,19) |
| InChIKey | IFGJIKNLCJGPPQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |