About 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea
1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea (PubChem CID 53498070) has the molecular formula C14H20N4O4S
and a molecular weight of 340.41 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea |
| PubChem CID | 53498070 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea |
| SMILES | O=C(Nc1ccc(N2CCOCC2)nc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20N4O4S/c19-14(17-12-3-8-23(20,21)10-12)16-11-1-2-13(15-9-11)18-4-6-22-7-5-18/h1-2,9,12H,3-8,10H2,(H2,16,17,19) |
| InChIKey | IFGJIKNLCJGPPQ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea (CID 53498070) is 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea is O=C(Nc1ccc(N2CCOCC2)nc1)NC1CCS(=O)(=O)C1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea?
The InChIKey is IFGJIKNLCJGPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O4S/c19-14(17-12-3-8-23(20,21)10-12)16-11-1-2-13(15-9-11)18-4-6-22-7-5-18/h1-2,9,12H,3-8,10H2,(H2,16,17,19).
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea?
1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea has a molecular weight of 340.41 g/mol, XLogP of 0.23, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-3-(6-morpholin-4-yl-3-pyridinyl)urea is sourced from PubChem (CID 53498070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).