About 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea (PubChem CID 96534678) has the molecular formula C17H24N4O4S
and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea.
Molecular Properties
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea |
| PubChem CID | 96534678 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)Nc1ccc(N2CCOCC2)nc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N4O4S/c1-2-6-21(15-5-11-26(23,24)13-15)17(22)19-14-3-4-16(18-12-14)20-7-9-25-10-8-20/h2-4,12,15H,1,5-11,13H2,(H,19,22)/t15-/m0/s1 |
| InChIKey | QVCHCDSGJAZWDU-HNNXBMFYSA-N |
| XLogP | 1.13 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea?
The IUPAC name of 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea (CID 96534678) is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea.
What is the SMILES notation for 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea?
The canonical SMILES for 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea is C=CCN(C(=O)Nc1ccc(N2CCOCC2)nc1)[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea?
The InChIKey is QVCHCDSGJAZWDU-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H24N4O4S/c1-2-6-21(15-5-11-26(23,24)13-15)17(22)19-14-3-4-16(18-12-14)20-7-9-25-10-8-20/h2-4,12,15H,1,5-11,13H2,(H,19,22)/t15-/m0/s1.
What are the key properties of 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea?
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea has a molecular weight of 380.47 g/mol, XLogP of 1.13, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea is sourced from PubChem (CID 96534678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).