C17H24N4O4S — CID 96534678
1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea (PubChem CID 96534678) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 96534678 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-(6-morpholin-4-yl-3-pyridinyl)-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)Nc1ccc(N2CCOCC2)nc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H24N4O4S/c1-2-6-21(15-5-11-26(23,24)13-15)17(22)19-14-3-4-16(18-12-14)20-7-9-25-10-8-20/h2-4,12,15H,1,5-11,13H2,(H,19,22)/t15-/m0/s1 |
| InChIKey | QVCHCDSGJAZWDU-HNNXBMFYSA-N |
| XLogP | 1.13 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|