C25H35N9O4 — CID 58770319
4-[6-amino-5-[(E)-2-morpholin-4-ylethoxyiminomethyl]pyrimidin-4-yl]-N-(6-cyclobutyloxy-3-pyridinyl)piperazine-1-carboxamide (PubChem CID 58770319) has the molecular formula C25H35N9O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is 4-[6-amino-5-[(E)-2-morpholin-4-ylethoxyiminomethyl]pyrimidin-4-yl]-N-(6-cyclobutyloxy-3-pyridinyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-amino-5-[(E)-2-morpholin-4-ylethoxyiminomethyl]pyrimidin-4-yl]-N-(6-cyclobutyloxy-3-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58770319 |
| Molecular Formula | C25H35N9O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 4-[6-amino-5-[(E)-2-morpholin-4-ylethoxyiminomethyl]pyrimidin-4-yl]-N-(6-cyclobutyloxy-3-pyridinyl)piperazine-1-carboxamide |
| SMILES | Nc1ncnc(N2CCN(C(=O)Nc3ccc(OC4CCC4)nc3)CC2)c1/C=N/OCCN1CCOCC1 |
| InChI | InChI=1S/C25H35N9O4/c26-23-21(17-30-37-15-12-32-10-13-36-14-11-32)24(29-18-28-23)33-6-8-34(9-7-33)25(35)31-19-4-5-22(27-16-19)38-20-2-1-3-20/h4-5,16-18,20H,1-3,6-15H2,(H,31,35)(H2,26,28,29)/b30-17+ |
| InChIKey | IJXTUIFBJCMLTH-OCSSWDANSA-N |
| XLogP | 1.42 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|