C24H25ClF2N6O3 — CID 73407115
4-N-[3-chloro-4-[(3,5-difluorophenyl)methoxy]phenyl]-5-(2-morpholin-4-ylethoxyiminomethyl)pyrimidine-4,6-diamine (PubChem CID 73407115) has the molecular formula C24H25ClF2N6O3 and a molecular weight of 518.95 g/mol. Its IUPAC name is 4-N-[3-chloro-4-[(3,5-difluorophenyl)methoxy]phenyl]-5-(2-morpholin-4-ylethoxyiminomethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-[3-chloro-4-[(3,5-difluorophenyl)methoxy]phenyl]-5-(2-morpholin-4-ylethoxyiminomethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 73407115 |
| Molecular Formula | C24H25ClF2N6O3 |
| Molecular Weight | 518.95 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 4-N-[3-chloro-4-[(3,5-difluorophenyl)methoxy]phenyl]-5-(2-morpholin-4-ylethoxyiminomethyl)pyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(Nc2ccc(OCc3cc(F)cc(F)c3)c(Cl)c2)c1C=NOCCN1CCOCC1 |
| InChI | InChI=1S/C24H25ClF2N6O3/c25-21-12-19(1-2-22(21)35-14-16-9-17(26)11-18(27)10-16)32-24-20(23(28)29-15-30-24)13-31-36-8-5-33-3-6-34-7-4-33/h1-2,9-13,15H,3-8,14H2,(H3,28,29,30,32) |
| InChIKey | UCWPGWBMXMLPJS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|