C28H28ClFN4O3 — CID 24737854
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine (PubChem CID 24737854) has the molecular formula C28H28ClFN4O3 and a molecular weight of 523.01 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 24737854 |
| Molecular Formula | C28H28ClFN4O3 |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine |
| SMILES | Fc1cccc(COc2ccc(Nc3ncnc4ccc(OCCCN5CCOCC5)cc34)cc2Cl)c1 |
| InChI | InChI=1S/C28H28ClFN4O3/c29-25-16-22(5-8-27(25)37-18-20-3-1-4-21(30)15-20)33-28-24-17-23(6-7-26(24)31-19-32-28)36-12-2-9-34-10-13-35-14-11-34/h1,3-8,15-17,19H,2,9-14,18H2,(H,31,32,33) |
| InChIKey | PNODKUMFVJVNDY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|