C26H22ClFN4O2S — CID 59982240
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 59982240) has the molecular formula C26H22ClFN4O2S and a molecular weight of 509.01 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59982240 |
| Molecular Formula | C26H22ClFN4O2S |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-(3-morpholin-4-ylprop-1-ynyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | Fc1cccc(COc2ccc(Nc3ncnc4cc(C#CCN5CCOCC5)sc34)cc2Cl)c1 |
| InChI | InChI=1S/C26H22ClFN4O2S/c27-22-14-20(6-7-24(22)34-16-18-3-1-4-19(28)13-18)31-26-25-23(29-17-30-26)15-21(35-25)5-2-8-32-9-11-33-12-10-32/h1,3-4,6-7,13-15,17H,8-12,16H2,(H,29,30,31) |
| InChIKey | IULYRAPVRWCQQC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|