C31H20ClFN4O3S — CID 59982270
2-[4-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]but-3-yn-2-yl]isoindole-1,3-dione (PubChem CID 59982270) has the molecular formula C31H20ClFN4O3S and a molecular weight of 583.04 g/mol. Its IUPAC name is 2-[4-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]but-3-yn-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]but-3-yn-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59982270 |
| Molecular Formula | C31H20ClFN4O3S |
| Molecular Weight | 583.04 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 2-[4-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]but-3-yn-2-yl]isoindole-1,3-dione |
| SMILES | CC(C#Cc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2s1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H20ClFN4O3S/c1-18(37-30(38)23-7-2-3-8-24(23)31(37)39)9-11-22-15-26-28(41-22)29(35-17-34-26)36-21-10-12-27(25(32)14-21)40-16-19-5-4-6-20(33)13-19/h2-8,10,12-15,17-18H,16H2,1H3,(H,34,35,36) |
| InChIKey | VUFXCQILYNPLFZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.04 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|