C24H20ClFN4OS — CID 59982233
6-(3-aminopent-1-ynyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 59982233) has the molecular formula C24H20ClFN4OS and a molecular weight of 466.97 g/mol. Its IUPAC name is 6-(3-aminopent-1-ynyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-(3-aminopent-1-ynyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59982233 |
| Molecular Formula | C24H20ClFN4OS |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 6-(3-aminopent-1-ynyl)-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCC(N)C#Cc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2s1 |
| InChI | InChI=1S/C24H20ClFN4OS/c1-2-17(27)6-8-19-12-21-23(32-19)24(29-14-28-21)30-18-7-9-22(20(25)11-18)31-13-15-4-3-5-16(26)10-15/h3-5,7,9-12,14,17H,2,13,27H2,1H3,(H,28,29,30) |
| InChIKey | DTOMFNOUOYDPMY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|