C22H15ClFN3O2S — CID 10151977
3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]prop-2-yn-1-ol (PubChem CID 10151977) has the molecular formula C22H15ClFN3O2S and a molecular weight of 439.90 g/mol. Its IUPAC name is 3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 10151977 |
| Molecular Formula | C22H15ClFN3O2S |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2s1 |
| InChI | InChI=1S/C22H15ClFN3O2S/c23-18-10-16(6-7-20(18)29-12-14-3-1-4-15(24)9-14)27-22-21-19(25-13-26-22)11-17(30-21)5-2-8-28/h1,3-4,6-7,9-11,13,28H,8,12H2,(H,25,26,27) |
| InChIKey | JEDLITHPWNLHNU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|