C31H27ClFN5O3S — CID 44532937
2-[2-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]ethynyl]-2-pyridinyl]methylamino]ethoxy]ethanol (PubChem CID 44532937) has the molecular formula C31H27ClFN5O3S and a molecular weight of 604.11 g/mol. Its IUPAC name is 2-[2-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]ethynyl]-2-pyridinyl]methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]ethynyl]-2-pyridinyl]methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 44532937 |
| Molecular Formula | C31H27ClFN5O3S |
| Molecular Weight | 604.11 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 2-[2-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]ethynyl]-2-pyridinyl]methylamino]ethoxy]ethanol |
| SMILES | OCCOCCNCc1cccc(C#Cc2cc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3s2)n1 |
| InChI | InChI=1S/C31H27ClFN5O3S/c32-27-16-24(8-10-29(27)41-19-21-3-1-4-22(33)15-21)38-31-30-28(35-20-36-31)17-26(42-30)9-7-23-5-2-6-25(37-23)18-34-11-13-40-14-12-39/h1-6,8,10,15-17,20,34,39H,11-14,18-19H2,(H,35,36,38) |
| InChIKey | JNODBROLUCYUGC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.11 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|