C28H22ClFN6O — CID 11591603
3-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]-2-pyridinyl]methylamino]propanenitrile (PubChem CID 11591603) has the molecular formula C28H22ClFN6O and a molecular weight of 512.98 g/mol. Its IUPAC name is 3-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]-2-pyridinyl]methylamino]propanenitrile.
| Compound Name | 3-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]-2-pyridinyl]methylamino]propanenitrile |
|---|---|
| PubChem CID | 11591603 |
| Molecular Formula | C28H22ClFN6O |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 3-[[6-[2-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]pyrimidin-5-yl]ethynyl]-2-pyridinyl]methylamino]propanenitrile |
| SMILES | N#CCCNCc1cccc(C#Cc2cncnc2Nc2ccc(OCc3cccc(F)c3)c(Cl)c2)n1 |
| InChI | InChI=1S/C28H22ClFN6O/c29-26-15-24(10-11-27(26)37-18-20-4-1-5-22(30)14-20)36-28-21(16-33-19-34-28)8-9-23-6-2-7-25(35-23)17-32-13-3-12-31/h1-2,4-7,10-11,14-16,19,32H,3,13,17-18H2,(H,33,34,36) |
| InChIKey | XHIHOTJXZKGOBN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|