C26H20ClFN6O2S — CID 59982242
1-[3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[2,3-d]pyrimidin-6-yl]prop-2-ynyl]-3-(2-cyanoethyl)urea (PubChem CID 59982242) has the molecular formula C26H20ClFN6O2S and a molecular weight of 535.00 g/mol. Its IUPAC name is 1-[3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[2,3-d]pyrimidin-6-yl]prop-2-ynyl]-3-(2-cyanoethyl)urea.
| Compound Name | 1-[3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[2,3-d]pyrimidin-6-yl]prop-2-ynyl]-3-(2-cyanoethyl)urea |
|---|---|
| PubChem CID | 59982242 |
| Molecular Formula | C26H20ClFN6O2S |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 1-[3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]thieno[2,3-d]pyrimidin-6-yl]prop-2-ynyl]-3-(2-cyanoethyl)urea |
| SMILES | N#CCCNC(=O)NCC#Cc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2s1 |
| InChI | InChI=1S/C26H20ClFN6O2S/c27-22-13-19(7-8-23(22)36-15-17-4-1-5-18(28)12-17)34-24-21-14-20(37-25(21)33-16-32-24)6-2-10-30-26(35)31-11-3-9-29/h1,4-5,7-8,12-14,16H,3,10-11,15H2,(H2,30,31,35)(H,32,33,34) |
| InChIKey | PFHWCZCZURCNQF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|